EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22Cl2FN5O |
| Net Charge | 0 |
| Average Mass | 450.345 |
| Monoisotopic Mass | 449.11854 |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3CCNCC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H22Cl2FN5O/c1-12(19-16(22)2-3-17(24)20(19)23)30-18-8-13(9-27-21(18)25)14-10-28-29(11-14)15-4-6-26-7-5-15/h2-3,8-12,15,26H,4-7H2,1H3,(H2,25,27)/t12-/m1/s1 |
| InChIKey | KTEIFNKAUNYNJU-GFCCVEGCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crizotinib (CHEBI:64310) has role antineoplastic agent (CHEBI:35610) |
| crizotinib (CHEBI:64310) has role biomarker (CHEBI:59163) |
| crizotinib (CHEBI:64310) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| crizotinib (CHEBI:64310) is a 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(piperidin-4-yl)pyrazol-4-yl]pyridin-2-amine (CHEBI:77562) |
| crizotinib (CHEBI:64310) is enantiomer of ent-crizotinib (CHEBI:77555) |
| Incoming Relation(s) |
| rac-crizotinib (CHEBI:77563) has part crizotinib (CHEBI:64310) |
| ent-crizotinib (CHEBI:77555) is enantiomer of crizotinib (CHEBI:64310) |
| IUPAC Name |
|---|
| 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(piperidin-4-yl)-1H-pyrazol-4-yl]pyridin-2-amine |
| INNs | Source |
|---|---|
| crizotinib | KEGG DRUG |
| crizotinibum | WHO MedNet |
| crizotinib | WHO MedNet |
| crizotinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| PF-2341066 | ChemIDplus |
| PF 2341066 | ChemIDplus |
| (R)-crizotinib | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D09731 | KEGG DRUG |
| Crizotinib | Wikipedia |
| LSM-1027 | LINCS |
| 4187 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12133926 | Reaxys |
| CAS:877399-52-5 | KEGG DRUG |
| CAS:877399-52-5 | ChemIDplus |
| Citations |
|---|