EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O2 |
| Net Charge | 0 |
| Average Mass | 400.647 |
| Monoisotopic Mass | 400.33413 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)C)[C@]1([H])C(=O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C27H44O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-23,25,28H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,25+,26+,27-/m1/s1 |
| InChIKey | YIKKMWSQVKJCOP-ABXCMAEBSA-N |
| Roles Classification |
|---|
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-ketocholesterol (CHEBI:64294) has functional parent cholesterol (CHEBI:16113) |
| 7-ketocholesterol (CHEBI:64294) has role neuroprotective agent (CHEBI:63726) |
| 7-ketocholesterol (CHEBI:64294) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 7-ketocholesterol (CHEBI:64294) is a 3β-sterol (CHEBI:35348) |
| 7-ketocholesterol (CHEBI:64294) is a 7-oxo steroid (CHEBI:47789) |
| 7-ketocholesterol (CHEBI:64294) is a cholestanoid (CHEBI:50401) |
| IUPAC Name |
|---|
| 3β-hydroxycholest-5-en-7-one |
| Synonyms | Source |
|---|---|
| (3-beta)-3-Hydroxycholest-5-en-7-one | ChemIDplus |
| 3-beta-Hydroxycholest-5-en-7-one | ChemIDplus |
| (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one | SUBMITTER |
| 7-oxocholesterol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 7-oxocholesterol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2169084 | Reaxys |
| CAS:566-28-9 | ChemIDplus |
| Citations |
|---|