EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6429 - Leurosidine
| Formula | C46H58N4O9 |
| Net Charge | 0 |
| Average Mass | 810.989 |
| Monoisotopic Mass | 810.42038 |
| SMILES | [H][C@@]12N(C)c3cc(OC)c([C@@]4(C(=O)OC)C[C@@H]5C[N@](CCc6c4nc4ccccc64)C[C@@](O)(CC)C5)cc3[C@@]13CCN1CC=C[C@@](CC)([C@@H](OC(C)=O)[C@]2(O)C(=O)OC)[C@]13[H] |
| InChI | InChI=1S/C46H58N4O9/c1-8-42(54)23-28-24-45(40(52)57-6,36-30(15-19-49(25-28)26-42)29-13-10-11-14-33(29)47-36)32-21-31-34(22-35(32)56-5)48(4)38-44(31)17-20-50-18-12-16-43(9-2,37(44)50)39(59-27(3)51)46(38,55)41(53)58-7/h10-14,16,21-22,28,37-39,47,54-55H,8-9,15,17-20,23-26H2,1-7H3/t28-,37+,38-,39-,42-,43-,44-,45+,46+/m1/s1 |
| InChIKey | JXLYSJRDGCGARV-DVOOFMKJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leurosidine (CHEBI:6429) is a vinca alkaloid (CHEBI:27288) |
| Synonyms | Source |
|---|---|
| Leurosidine | KEGG COMPOUND |
| Vinrosidine | KEGG COMPOUND |