EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N3O3 |
| Net Charge | 0 |
| Average Mass | 187.199 |
| Monoisotopic Mass | 187.09569 |
| SMILES | CC(CCNC(=N)N)C(=O)C(=O)O |
| InChI | InChI=1S/C7H13N3O3/c1-4(5(11)6(12)13)2-3-10-7(8)9/h4H,2-3H2,1H3,(H,12,13)(H4,8,9,10) |
| InChIKey | HLXRGRMMMNFZHD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-guanidino-3-methyl-2-oxopentanoic acid (CHEBI:64288) has functional parent valeric acid (CHEBI:17418) |
| 5-guanidino-3-methyl-2-oxopentanoic acid (CHEBI:64288) has part guanidino group (CHEBI:48551) |
| 5-guanidino-3-methyl-2-oxopentanoic acid (CHEBI:64288) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 5-guanidino-3-methyl-2-oxopentanoic acid (CHEBI:64288) is tautomer of 5-guanidino-3-methyl-2-oxopentanoic acid zwitterion (CHEBI:64263) |
| Incoming Relation(s) |
| 5-guanidino-3-methyl-2-oxopentanoic acid zwitterion (CHEBI:64263) is tautomer of 5-guanidino-3-methyl-2-oxopentanoic acid (CHEBI:64288) |
| IUPAC Name |
|---|
| 5-carbamimidamido-3-methyl-2-oxopentanoic acid |
| Citations |
|---|