EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O4 |
| Net Charge | 0 |
| Average Mass | 204.181 |
| Monoisotopic Mass | 204.04226 |
| SMILES | O=C(O)c1ccc2c(O)ccc(O)c2c1 |
| InChI | InChI=1S/C11H8O4/c12-9-3-4-10(13)8-5-6(11(14)15)1-2-7(8)9/h1-5,12-13H,(H,14,15) |
| InChIKey | HVZYIHBMRFYBRI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-dihydroxy-6-naphthoic acid (CHEBI:64284) is a monocarboxylic acid (CHEBI:25384) |
| 1,4-dihydroxy-6-naphthoic acid (CHEBI:64284) is a naphthalenediols (CHEBI:23783) |
| 1,4-dihydroxy-6-naphthoic acid (CHEBI:64284) is a naphthohydroquinone (CHEBI:51475) |
| 1,4-dihydroxy-6-naphthoic acid (CHEBI:64284) is conjugate acid of 1,4-dihydroxy-6-naphthoate (CHEBI:64254) |
| Incoming Relation(s) |
| 1,4-dihydroxy-6-naphthoate (CHEBI:64254) is conjugate base of 1,4-dihydroxy-6-naphthoic acid (CHEBI:64284) |
| IUPAC Name |
|---|
| 5,8-dihydroxy-2-naphthoic acid |
| Manual Xrefs | Databases |
|---|---|
| C17018 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19930666 | Reaxys |