EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=C/C(C)=C/CC=C(C)C |
| InChI | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7-8H,1,6H2,2-4H3/b10-8+ |
| InChIKey | IHPKGUQCSIINRJ-CSKARUKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pinus pinea (ncbitaxon:3346) | - | PubMed (12428002) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-β-ocimene (CHEBI:64280) has role plant metabolite (CHEBI:76924) |
| (E)-β-ocimene (CHEBI:64280) is a β-ocimene (CHEBI:10436) |
| IUPAC Name |
|---|
| (3E)-3,7-dimethylocta-1,3,6-triene |
| Synonyms | Source |
|---|---|
| 3,7-dimethyl-1,3E,6-octatriene | LIPID MAPS |
| (E)-3,7-dimethylocta-1,3,6-triene | ChEBI |
| trans-3,7-dimethylocta-1,3,6-triene | ChEBI |
| trans-beta-Ocimene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (E)-β-ocimene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1390 | BPDB |
| C00029335 | KNApSAcK |
| C09873 | KEGG COMPOUND |
| CPD-4889 | MetaCyc |
| LMPR0102010021 | LIPID MAPS |
| US2011165115 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1839945 | Reaxys |
| CAS:13877-91-3 | KEGG COMPOUND |
| CAS:3779-61-1 | ChemIDplus |
| Citations |
|---|