EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H64N4O16 |
| Net Charge | 0 |
| Average Mass | 844.953 |
| Monoisotopic Mass | 844.43173 |
| SMILES | [H][C@]1([C@]([H])(O)C[C@H]2O[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3NC(C)=O)[C@H](NC(=O)/C=C/CCCCCCCCCCC(C)C)[C@@H](O)[C@H]2O)O[C@@H](n2ccc(=O)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C39H64N4O16/c1-20(2)14-12-10-8-6-4-5-7-9-11-13-15-25(47)41-28-32(52)29(49)23(56-38(28)59-37-27(40-21(3)45)31(51)30(50)24(19-44)57-37)18-22(46)35-33(53)34(54)36(58-35)43-17-16-26(48)42-39(43)55/h13,15-17,20,22-24,27-38,44,46,49-54H,4-12,14,18-19H2,1-3H3,(H,40,45)(H,41,47)(H,42,48,55)/b15-13+/t22-,23-,24-,27-,28-,29+,30-,31-,32-,33+,34-,35-,36-,37-,38+/m1/s1 |
| InChIKey | ZOCXUHJGZXXIGQ-NPXWYGMKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces xinghaiensis (ncbitaxon:1038928) | - | PubMed (30445836) | Strain: SCSIO S15077 |
| Streptomyces sp. DUT11 (ncbitaxon:1914992) | - | PubMed (29973921) | |
| Lolium rigidum (ncbitaxon:89674) | - | Article (Book: Dictionary of Organic Compounds, John Buckingham, 1987, Part 1, Page 715) | Isolated from Lolium rigidum infected with Corynebacterium rathayi. |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tunicamycin C1 (CHEBI:64256) has role antimicrobial agent (CHEBI:33281) |
| tunicamycin C1 (CHEBI:64256) has role bacterial metabolite (CHEBI:76969) |
| tunicamycin C1 (CHEBI:64256) has role marine metabolite (CHEBI:76507) |
| tunicamycin C1 (CHEBI:64256) is a nucleoside (CHEBI:33838) |
| Incoming Relation(s) |
| tunicamycin (CHEBI:29699) has part tunicamycin C1 (CHEBI:64256) |
| IUPAC Names |
|---|
| (5'R)-5'-[2-acetamido-2-deoxy-α-D-glucopyranosyl-(1↔1)-2,6-dideoxy-2-(14-methylpentadec-2-enamido)-β-D-galactopyranos-6-yl]uridine |
| (2E)-N-[(2S,3R,4R,5R,6R)-2-{[(2R,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy}-6-{(2R)-2-[(2R,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]-2-hydroxyethyl}-4,5-dihydroxytetrahydro-2H-pyran-3-yl]-14-methylpentadec-2-enamide |
| Synonyms | Source |
|---|---|
| tunicamycin VII | ChEBI |
| tunicamycin B | ChEBI |
| corynetoxin U-16I | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:66081-36-5 | ChemIDplus |
| Citations |
|---|