EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N3O2 |
| Net Charge | 0 |
| Average Mass | 403.526 |
| Monoisotopic Mass | 403.22598 |
| SMILES | [H][C@@]12Cc3cn(C)c4cccc(c34)[C@@]1([H])C[C@@H](CNC(=O)OCc1ccccc1)CN2C |
| InChI | InChI=1S/C25H29N3O2/c1-27-14-18(13-26-25(29)30-16-17-7-4-3-5-8-17)11-21-20-9-6-10-22-24(20)19(12-23(21)27)15-28(22)2/h3-10,15,18,21,23H,11-14,16H2,1-2H3,(H,26,29)/t18-,21+,23+/m0/s1 |
| InChIKey | WZHJKEUHNJHDLS-QTGUNEKASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopamine agonist A drug that binds to and activates dopamine receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopamine agonist A drug that binds to and activates dopamine receptors. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metergoline (CHEBI:64216) has role dopamine agonist (CHEBI:51065) |
| metergoline (CHEBI:64216) has role geroprotector (CHEBI:176497) |
| metergoline (CHEBI:64216) has role serotonergic antagonist (CHEBI:48279) |
| metergoline (CHEBI:64216) is a carbamate ester (CHEBI:23003) |
| metergoline (CHEBI:64216) is a ergoline alkaloid (CHEBI:60529) |
| IUPAC Name |
|---|
| benzyl {[(8α)-1,6-dimethylergolin-8-yl]methyl}carbamate |
| INNs | Source |
|---|---|
| metergolina | ChemIDplus |
| metergoline | KEGG DRUG |
| metergolinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,6-Dimethyl-8-beta-carbobenzyloxaminomethyl-10-alpha-ergoline | ChemIDplus |
| 1-Methyl-8-beta-carbobenzyloxyaminomethyl-10-alpha-ergoline | ChemIDplus |
| 1-Methyl-N-carbobenzyloxydihydro-D-lysergamin | ChemIDplus |
| (((8-beta)-1,6-Dimethylergolin-8-yl)methyl)carbamic acid benzyl ester | ChemIDplus |
| (((8-beta)-1,6-Dimethylergolin-8-yl)methyl)carbamic acid phenylmethyl ester | ChemIDplus |
| D-8-beta-((Carbobenzoxyamino)methyl)-1,6-dimethyl-10-alpha-ergoline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1723 | DrugCentral |
| D07218 | KEGG DRUG |
| LSM-3265 | LINCS |
| Metergoline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5362415 | Reaxys |
| CAS:17692-51-2 | NIST Chemistry WebBook |
| CAS:17692-51-2 | ChemIDplus |
| CAS:17692-51-2 | KEGG DRUG |
| Citations |
|---|