EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N3O2 |
| Net Charge | 0 |
| Average Mass | 403.526 |
| Monoisotopic Mass | 403.22598 |
| SMILES | [H][C@@]12Cc3cn(C)c4cccc(c34)[C@@]1([H])C[C@@H](CNC(=O)OCc1ccccc1)CN2C |
| InChI | InChI=1S/C25H29N3O2/c1-27-14-18(13-26-25(29)30-16-17-7-4-3-5-8-17)11-21-20-9-6-10-22-24(20)19(12-23(21)27)15-28(22)2/h3-10,15,18,21,23H,11-14,16H2,1-2H3,(H,26,29)/t18-,21+,23+/m0/s1 |
| InChIKey | WZHJKEUHNJHDLS-QTGUNEKASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | dopamine agonist A drug that binds to and activates dopamine receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | dopamine agonist A drug that binds to and activates dopamine receptors. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metergoline (CHEBI:64216) has role dopamine agonist (CHEBI:51065) |
| metergoline (CHEBI:64216) has role geroprotector (CHEBI:176497) |
| metergoline (CHEBI:64216) has role serotonergic antagonist (CHEBI:48279) |
| metergoline (CHEBI:64216) is a carbamate ester (CHEBI:23003) |
| metergoline (CHEBI:64216) is a ergoline alkaloid (CHEBI:60529) |
| IUPAC Name |
|---|
| benzyl {[(8α)-1,6-dimethylergolin-8-yl]methyl}carbamate |
| INNs | Source |
|---|---|
| metergolina | ChemIDplus |
| metergoline | KEGG DRUG |
| metergolinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,6-Dimethyl-8-beta-carbobenzyloxaminomethyl-10-alpha-ergoline | ChemIDplus |
| 1-Methyl-8-beta-carbobenzyloxyaminomethyl-10-alpha-ergoline | ChemIDplus |
| 1-Methyl-N-carbobenzyloxydihydro-D-lysergamin | ChemIDplus |
| (((8-beta)-1,6-Dimethylergolin-8-yl)methyl)carbamic acid benzyl ester | ChemIDplus |
| (((8-beta)-1,6-Dimethylergolin-8-yl)methyl)carbamic acid phenylmethyl ester | ChemIDplus |
| D-8-beta-((Carbobenzoxyamino)methyl)-1,6-dimethyl-10-alpha-ergoline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1723 | DrugCentral |
| D07218 | KEGG DRUG |
| LSM-3265 | LINCS |
| Metergoline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5362415 | Reaxys |
| CAS:17692-51-2 | NIST Chemistry WebBook |
| CAS:17692-51-2 | KEGG DRUG |
| CAS:17692-51-2 | ChemIDplus |
| Citations |
|---|