EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11BrN5O6P |
| Net Charge | 0 |
| Average Mass | 408.105 |
| Monoisotopic Mass | 406.96303 |
| SMILES | Nc1ncnc2c1nc(Br)n2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C10H11BrN5O6P/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-5(17)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,17H,1H2,(H,18,19)(H2,12,13,14)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DVKQVRZMKBDMDH-UUOKFMHZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | protein kinase agonist An agonist that selectively binds to and activates a protein kinase receptor. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-Br-cAMP (CHEBI:64211) has functional parent 3',5'-cyclic AMP (CHEBI:17489) |
| 8-Br-cAMP (CHEBI:64211) has role antidepressant (CHEBI:35469) |
| 8-Br-cAMP (CHEBI:64211) has role protein kinase agonist (CHEBI:64106) |
| 8-Br-cAMP (CHEBI:64211) is a 3',5'-cyclic purine nucleotide (CHEBI:19834) |
| 8-Br-cAMP (CHEBI:64211) is a adenyl ribonucleotide (CHEBI:61296) |
| 8-Br-cAMP (CHEBI:64211) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| 8-bromoadenosine 3',5'-(hydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 8-bromo cyclic adenosine monophosphate | ChemIDplus |
| 8-bromo-cyclic 3',5'-AMP | ChemIDplus |
| 8-bromoadenosine cyclic 3',5'-phosphate | ChemIDplus |
| 8-bromoadenosine 3',5'-cyclic monophosphate | ChemIDplus |
| 8-bromo-cyclic AMP | ChemIDplus |
| cyclic 8-bromoadenosine 3',5'-monophosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 8-Bromoadenosine_3',5'-cyclic_monophosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:591930 | Reaxys |
| CAS:23583-48-4 | ChemIDplus |
| Citations |
|---|