EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO3 |
| Net Charge | 0 |
| Average Mass | 351.446 |
| Monoisotopic Mass | 351.18344 |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)Nc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C22H25NO3/c1-21(2)11-12-22(3,4)18-13-15(7-10-17(18)21)19(24)23-16-8-5-14(6-9-16)20(25)26/h5-10,13H,11-12H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | SZWKGOZKRMMLAJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | retinoic acid receptor alpha/beta agonist Any retinoic acid receptor (RAR) agonist with specificity for RARα and RARβ. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. retinoic acid receptor alpha/beta agonist Any retinoic acid receptor (RAR) agonist with specificity for RARα and RARβ. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-{[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbonyl]amino}benzoic acid (CHEBI:64210) has role antineoplastic agent (CHEBI:35610) |
| 4-{[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbonyl]amino}benzoic acid (CHEBI:64210) has role retinoic acid receptor α/β agonist (CHEBI:50741) |
| 4-{[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbonyl]amino}benzoic acid (CHEBI:64210) is a amidobenzoic acid (CHEBI:48470) |
| 4-{[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbonyl]amino}benzoic acid (CHEBI:64210) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| 4-{[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbonyl]amino}benzoic acid |
| Synonyms | Source |
|---|---|
| Am 580 | ChemIDplus |
| AM-580 | ChemIDplus |
| AM580 | ChEBI |
| CD 336 | ChemIDplus |
| CD-336 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3565084 | Reaxys |
| CAS:102121-60-8 | KEGG COMPOUND |
| CAS:102121-60-8 | ChemIDplus |
| Citations |
|---|