EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26FN3O2 |
| Net Charge | 0 |
| Average Mass | 383.467 |
| Monoisotopic Mass | 383.20091 |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(CCCOc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C22H26FN3O2/c23-18-7-9-20(10-8-18)28-16-4-13-25-14-11-22(12-15-25)21(27)24-17-26(22)19-5-2-1-3-6-19/h1-3,5-10H,4,11-17H2,(H,24,27) |
| InChIKey | FJUKDAZEABGEIH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiramide (CHEBI:64207) has role dopaminergic antagonist (CHEBI:48561) |
| spiramide (CHEBI:64207) has role serotonergic antagonist (CHEBI:48279) |
| spiramide (CHEBI:64207) is a aromatic ether (CHEBI:35618) |
| spiramide (CHEBI:64207) is a azaspiro compound (CHEBI:35624) |
| spiramide (CHEBI:64207) is a organofluorine compound (CHEBI:37143) |
| spiramide (CHEBI:64207) is a piperidines (CHEBI:26151) |
| spiramide (CHEBI:64207) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 8-[3-(4-fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| INNs | Source |
|---|---|
| espiramida | ChemIDplus |
| spiramidum | ChemIDplus |
| spiramide | ChemIDplus |
| spiramide | WHO MedNet |
| Synonym | Source |
|---|---|
| AMI-193 | ChEBI |
| Citations |
|---|