EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26FN3O2 |
| Net Charge | 0 |
| Average Mass | 383.467 |
| Monoisotopic Mass | 383.20091 |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(CCCOc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C22H26FN3O2/c23-18-7-9-20(10-8-18)28-16-4-13-25-14-11-22(12-15-25)21(27)24-17-26(22)19-5-2-1-3-6-19/h1-3,5-10H,4,11-17H2,(H,24,27) |
| InChIKey | FJUKDAZEABGEIH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiramide (CHEBI:64207) has role dopaminergic antagonist (CHEBI:48561) |
| spiramide (CHEBI:64207) has role serotonergic antagonist (CHEBI:48279) |
| spiramide (CHEBI:64207) is a aromatic ether (CHEBI:35618) |
| spiramide (CHEBI:64207) is a azaspiro compound (CHEBI:35624) |
| spiramide (CHEBI:64207) is a organofluorine compound (CHEBI:37143) |
| spiramide (CHEBI:64207) is a piperidines (CHEBI:26151) |
| spiramide (CHEBI:64207) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 8-[3-(4-fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| INNs | Source |
|---|---|
| espiramida | ChemIDplus |
| spiramide | ChemIDplus |
| spiramide | WHO MedNet |
| spiramidum | ChemIDplus |
| Synonym | Source |
|---|---|
| AMI-193 | ChEBI |
| Citations |
|---|