EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8OS2 |
| Net Charge | 0 |
| Average Mass | 124.230 |
| Monoisotopic Mass | 124.00166 |
| SMILES | OCC(S)CS |
| InChI | InChI=1S/C3H8OS2/c4-1-3(6)2-5/h3-6H,1-2H2 |
| InChIKey | WQABCVAJNWAXTE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimercaprol (CHEBI:64198) has role chelator (CHEBI:38161) |
| dimercaprol (CHEBI:64198) is a dithiol (CHEBI:23853) |
| dimercaprol (CHEBI:64198) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| dithioglycerophosphocholine (CHEBI:140065) has functional parent dimercaprol (CHEBI:64198) |
| IUPAC Name |
|---|
| 2,3-disulfanylpropan-1-ol |
| INNs | Source |
|---|---|
| dimercaprol | ChemIDplus |
| dimercaprolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,2-dimercapto-3-propanol | ChemIDplus |
| 1,2-dithioglycerol | ChemIDplus |
| 1-propanol, 2,3-dimercapto | ChEMBL |
| 2,3-dimercapto-1-propanol | ChemIDplus |
| 2,3-Dimercapto-1-propanol | KEGG COMPOUND |
| 2,3,-dimercapto-1-propanol | ChEMBL |
| Brand Names | Source |
|---|---|
| Anti-lewisite | ChEMBL |
| B.a.l. | ChEMBL |
| Citations |
|---|