EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N6O2 |
| Net Charge | 0 |
| Average Mass | 300.322 |
| Monoisotopic Mass | 300.13347 |
| SMILES | Nc1nc(NC2CC2)c2ncn([C@H]3C=C[C@@H](C(=O)O)C3)c2n1 |
| InChI | InChI=1S/C14H16N6O2/c15-14-18-11(17-8-2-3-8)10-12(19-14)20(6-16-10)9-4-1-7(5-9)13(21)22/h1,4,6-9H,2-3,5H2,(H,21,22)(H3,15,17,18,19)/t7-,9+/m1/s1 |
| InChIKey | OCSMNHMMTKMVCP-APPZFPTMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abacavir 5'-carboxylic acid (CHEBI:64192) has functional parent abacavir (CHEBI:421707) |
| abacavir 5'-carboxylic acid (CHEBI:64192) has role metabolite (CHEBI:25212) |
| abacavir 5'-carboxylic acid (CHEBI:64192) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (1S,4R)-4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]cyclopent-2-ene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5'-oxoabacavir | ChEBI |
| abacavir 5'-carboxylate | ChEBI |
| abacavir carboxylate | ChEBI |
| abacavir carboxylic acid | ChEBI |
| Citations |
|---|