EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N6O7 |
| Net Charge | 0 |
| Average Mass | 462.463 |
| Monoisotopic Mass | 462.18630 |
| SMILES | Nc1nc(NC2CC2)c2ncn([C@H]3C=C[C@@H](CO[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)C3)c2n1 |
| InChI | InChI=1S/C20H26N6O7/c21-20-24-16(23-9-2-3-9)11-17(25-20)26(7-22-11)10-4-1-8(5-10)6-32-19-14(29)12(27)13(28)15(33-19)18(30)31/h1,4,7-10,12-15,19,27-29H,2-3,5-6H2,(H,30,31)(H3,21,23,24,25)/t8-,10+,12+,13+,14-,15+,19-/m1/s1 |
| InChIKey | WGTDUQBKKUUVMK-OLMRCODSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abacavir 5'-glucuronide (CHEBI:64189) has functional parent abacavir (CHEBI:421707) |
| abacavir 5'-glucuronide (CHEBI:64189) has role metabolite (CHEBI:25212) |
| abacavir 5'-glucuronide (CHEBI:64189) is a glucosiduronic acid (CHEBI:24302) |
| IUPAC Name |
|---|
| {(1S,4R)-4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]cyclopent-2-en-1-yl}methyl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 361W | ChEBI |
| abacavir glucosiduronic acid | ChEBI |
| abacavir 5'-glucosiduronic acid | ChEBI |
| abacavir glucuronide | ChEBI |
| Citations |
|---|