EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O16 |
| Net Charge | 0 |
| Average Mass | 504.438 |
| Monoisotopic Mass | 504.16903 |
| SMILES | OC[C@H]1O[C@@H](O[C@@H]2[C@H](O[C@H]3[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]3O)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,3,2/[a1122h-1a_1-5][a1122h-1b_1-5]/1-2-2/a2-b1_b2-c1 |
| InChI | InChI=1S/C18H32O16/c19-1-4-8(23)11(26)14(16(29)30-4)33-18-15(12(27)9(24)6(3-21)32-18)34-17-13(28)10(25)7(22)5(2-20)31-17/h4-29H,1-3H2/t4-,5-,6-,7-,8-,9-,10+,11+,12+,13+,14+,15+,16+,17+,18+/m1/s1 |
| InChIKey | UQBIAGWOJDEOMN-QGVHWXALSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-Manp-(1→2)-β-D-Manp-(1→2)-α-D-Manp (CHEBI:64170) has role epitope (CHEBI:53000) |
| β-D-Manp-(1→2)-β-D-Manp-(1→2)-α-D-Manp (CHEBI:64170) is a mannotriose (CHEBI:146181) |
| Incoming Relation(s) |
| β-D-Manp-(1→2)-β-D-Manp-(1→2)-α-D-Manp-(1→2)-Manp (CHEBI:149072) has functional parent β-D-Manp-(1→2)-β-D-Manp-(1→2)-α-D-Manp (CHEBI:64170) |
| β-D-Manp-(1→2)-β-D-Manp-(1→2)-α-D-Manp-O[CH2]2NH2 (CHEBI:78888) has functional parent β-D-Manp-(1→2)-β-D-Manp-(1→2)-α-D-Manp (CHEBI:64170) |
| β-D-mannosyl-(1→2)-β-D-mannosyl-(1→2)-α-D-mannoside—copovidone glycoconjugate (CHEBI:78898) has functional parent β-D-Manp-(1→2)-β-D-Manp-(1→2)-α-D-Manp (CHEBI:64170) |
| IUPAC Name |
|---|
| β-D-mannopyranosyl-(1→2)-β-D-mannopyranosyl-(1→2)-α-D-mannopyranose |
| Synonyms | Source |
|---|---|
| Manβ1→2Manβ1→2Manα | ChEBI |
| β-D-Man-(1→2)-β-D-Man-(1→2)-α-D-Man | ChEBI |
| β-D-mannosyl-(1→2)-β-D-mannosyl-(1→2)-α-D-mannose | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19194456 | Reaxys |
| Citations |
|---|