EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O8 |
| Net Charge | 0 |
| Average Mass | 322.269 |
| Monoisotopic Mass | 322.06887 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C15H14O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,13-22H/t13-,14-,15+/m0/s1 |
| InChIKey | ZEACOKJOQLAYTD-SOUVJXGZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S,4S)-leucodelphinidin (CHEBI:6417) has functional parent (+)-gallocatechin (CHEBI:31018) |
| (2R,3S,4S)-leucodelphinidin (CHEBI:6417) has role metabolite (CHEBI:25212) |
| (2R,3S,4S)-leucodelphinidin (CHEBI:6417) is a (2R,3S,4S)-leucoanthocyanidin (CHEBI:138176) |
| (2R,3S,4S)-leucodelphinidin (CHEBI:6417) is a flavan-3,3',4,4',5,5',7-heptol (CHEBI:71216) |
| (2R,3S,4S)-leucodelphinidin (CHEBI:6417) is a leucoanthocyanidin (CHEBI:60835) |
| IUPAC Name |
|---|
| (2R,3S,4S)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol |
| Synonyms | Source |
|---|---|
| (2R,3S,4S)-2-(3,4,5-trihydroxyphenyl)chroman-3,4,5,7-tetrol | ChEBI |
| (2R,3S,4S)-3,3',4,4',5,5',7-heptahydroxyflavan | ChEBI |
| (2R,3S,4S)-3,4,5,7,3',4',5'-heptahydroxyflavan | ChEBI |
| (2R,3S)-gallocatechin-4β-ol | ChEBI |
| Leucodelphinidin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00008992 | KNApSAcK |
| C00020637 | KNApSAcK |
| C05909 | KEGG COMPOUND |
| CPD-7088 | MetaCyc |
| Leucodelphinidin | Wikipedia |
| LMPK12020209 | LIPID MAPS |
| Citations |
|---|