EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2 |
| Net Charge | +2 |
| Average Mass | 184.242 |
| Monoisotopic Mass | 184.09895 |
| SMILES | c1cc[n+]2c(c1)-c1cccc[n+]1CC2 |
| InChI | InChI=1S/C12H12N2/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1/h1-8H,9-10H2/q+2 |
| InChIKey | SYJFEGQWDCRVNX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | defoliant A herbicide which when sprayed or dusted on plants causes its leaves to fall off. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diquat (CHEBI:64163) has parent hydride 2,2'-bipyridine (CHEBI:30351) |
| diquat (CHEBI:64163) has role defoliant (CHEBI:23582) |
| diquat (CHEBI:64163) has role herbicide (CHEBI:24527) |
| diquat (CHEBI:64163) is a organic cation (CHEBI:25697) |
| IUPAC Name |
|---|
| 6,7-dihydrodipyrido[1,2-a:2',1'-c]pyrazinediium |
| Synonyms | Source |
|---|---|
| 1,1'-Ethylene-2,2'-bipyridyldylium ion | ChemIDplus |
| 1,1'-Ethylene-2,2'-bipyridylium ion | ChemIDplus |
| 9,10-Dihydro-8a,10a-diazoniaphenanthrene | ChemIDplus |
| Diquat dication | ChemIDplus |