EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O8 |
| Net Charge | 0 |
| Average Mass | 318.237 |
| Monoisotopic Mass | 318.03757 |
| SMILES | O=C1c2c(cc(CO)c(O)c2O)C(=O)c2c(O)c(O)cc(O)c21 |
| InChI | InChI=1S/C15H10O8/c16-3-4-1-5-8(15(23)11(4)19)14(22)9-6(17)2-7(18)13(21)10(9)12(5)20/h1-2,16-19,21,23H,3H2 |
| InChIKey | DLOLMYKOOZLTPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperthecin (CHEBI:64161) has role biological pigment (CHEBI:26130) |
| asperthecin (CHEBI:64161) has role metabolite (CHEBI:25212) |
| asperthecin (CHEBI:64161) is a pentahydroxyanthraquinone (CHEBI:132198) |
| Incoming Relation(s) |
| 2,3,6,8,9-pentahydroxy-1-oxo-3-(2-oxopropyl)-1,2,3,4-tetrahydroanthracene-2-carboxylate (CHEBI:149683) has functional parent asperthecin (CHEBI:64161) |
| 2,3,6,8,9-pentahydroxy-3-(2-oxopropyl)-1,2,3,4-tetrahydroanthracen-1-one (CHEBI:146216) has functional parent asperthecin (CHEBI:64161) |
| IUPAC Name |
|---|
| 1,2,5,6,8-pentahydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2674392 | Reaxys |
| CAS:10089-00-6 | ChemIDplus |
| Citations |
|---|