EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O8 |
| Net Charge | 0 |
| Average Mass | 318.237 |
| Monoisotopic Mass | 318.03757 |
| SMILES | O=C1c2c(cc(CO)c(O)c2O)C(=O)c2c(O)c(O)cc(O)c21 |
| InChI | InChI=1S/C15H10O8/c16-3-4-1-5-8(15(23)11(4)19)14(22)9-6(17)2-7(18)13(21)10(9)12(5)20/h1-2,16-19,21,23H,3H2 |
| InChIKey | DLOLMYKOOZLTPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperthecin (CHEBI:64161) has role biological pigment (CHEBI:26130) |
| asperthecin (CHEBI:64161) has role metabolite (CHEBI:25212) |
| asperthecin (CHEBI:64161) is a pentahydroxyanthraquinone (CHEBI:132198) |
| Incoming Relation(s) |
| 2,3,6,8,9-pentahydroxy-1-oxo-3-(2-oxopropyl)-1,2,3,4-tetrahydroanthracene-2-carboxylate (CHEBI:149683) has functional parent asperthecin (CHEBI:64161) |
| 2,3,6,8,9-pentahydroxy-3-(2-oxopropyl)-1,2,3,4-tetrahydroanthracen-1-one (CHEBI:146216) has functional parent asperthecin (CHEBI:64161) |
| IUPAC Name |
|---|
| 1,2,5,6,8-pentahydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2674392 | Reaxys |
| CAS:10089-00-6 | ChemIDplus |
| Citations |
|---|