EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11N |
| Net Charge | 0 |
| Average Mass | 193.249 |
| Monoisotopic Mass | 193.08915 |
| SMILES | Cc1cccc(C#Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H11N/c1-12-6-5-9-14(15-12)11-10-13-7-3-2-4-8-13/h2-9H,1H3 |
| InChIKey | NEWKHUASLBMWRE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabotropic glutamate receptor antagonist An antagonist at the metabotropic glutamate receptor. |
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-6-(phenylethynyl)pyridine (CHEBI:64159) has parent hydride acetylene (CHEBI:27518) |
| 2-methyl-6-(phenylethynyl)pyridine (CHEBI:64159) has role anxiolytic drug (CHEBI:35474) |
| 2-methyl-6-(phenylethynyl)pyridine (CHEBI:64159) has role metabotropic glutamate receptor antagonist (CHEBI:63963) |
| 2-methyl-6-(phenylethynyl)pyridine (CHEBI:64159) is a acetylenic compound (CHEBI:73474) |
| 2-methyl-6-(phenylethynyl)pyridine (CHEBI:64159) is a methylpyridines (CHEBI:25340) |
| 2-methyl-6-(phenylethynyl)pyridine (CHEBI:64159) is conjugate base of 2-methyl-6-(phenylethynyl)pyridinium(1+) (CHEBI:64160) |
| Incoming Relation(s) |
| 2-methyl-6-(phenylethynyl)pyridinium(1+) (CHEBI:64160) is conjugate acid of 2-methyl-6-(phenylethynyl)pyridine (CHEBI:64159) |
| IUPAC Name |
|---|
| 2-methyl-6-(phenylethynyl)pyridine |
| Synonyms | Source |
|---|---|
| 6-Methyl-2-(phenylethynyl)pyridine | ChemIDplus |
| MPEP | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-4678 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:140513 | Reaxys |
| CAS:219911-35-0 | ChemIDplus |
| Citations |
|---|