EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11N.HCl |
| Net Charge | 0 |
| Average Mass | 229.710 |
| Monoisotopic Mass | 229.06583 |
| SMILES | Cc1cccc(C#Cc2ccccc2)n1.Cl |
| InChI | InChI=1S/C14H11N.ClH/c1-12-6-5-9-14(15-12)11-10-13-7-3-2-4-8-13;/h2-9H,1H3;1H |
| InChIKey | PKDHDJBNEKXCBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabotropic glutamate receptor antagonist An antagonist at the metabotropic glutamate receptor. |
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-6-(phenylethynyl)pyridine hydrochloride (CHEBI:64158) has part 2-methyl-6-(phenylethynyl)pyridinium(1+) (CHEBI:64160) |
| 2-methyl-6-(phenylethynyl)pyridine hydrochloride (CHEBI:64158) has role anxiolytic drug (CHEBI:35474) |
| 2-methyl-6-(phenylethynyl)pyridine hydrochloride (CHEBI:64158) has role metabotropic glutamate receptor antagonist (CHEBI:63963) |
| 2-methyl-6-(phenylethynyl)pyridine hydrochloride (CHEBI:64158) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-methyl-6-(phenylethynyl)pyridine hydrochloride |
| Synonyms | Source |
|---|---|
| MPEP hydrochloride | ChEBI |
| 2-methyl-6-(phenylethynyl)pyridinium chloride | IUPAC |
| 6-methyl-2-(phenylethynyl)pyridine hydrochloride | ChEBI |
| 6-methyl-2-(phenylethynyl)pyridinium chloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9652435 | Reaxys |
| Citations |
|---|