EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N4S |
| Net Charge | 0 |
| Average Mass | 170.241 |
| Monoisotopic Mass | 170.06262 |
| SMILES | N=C(N)SCCc1cncn1 |
| InChI | InChI=1S/C6H10N4S/c7-6(8)11-2-1-5-3-9-4-10-5/h3-4H,1-2H2,(H3,7,8)(H,9,10) |
| InChIKey | PEHSVUKQDJULKE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H4-receptor agonist A histamine agonist that binds to and activates H4-receptors. H3-receptor agonist A histamine agonist that binds to and activates histamine H3-receptors. |
| Applications: | H4-receptor agonist A histamine agonist that binds to and activates H4-receptors. H3-receptor agonist A histamine agonist that binds to and activates histamine H3-receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imetit (CHEBI:64156) has role H3-receptor agonist (CHEBI:64154) |
| imetit (CHEBI:64156) has role H4-receptor agonist (CHEBI:64155) |
| imetit (CHEBI:64156) is a imidazoles (CHEBI:24780) |
| imetit (CHEBI:64156) is a imidothiocarbamic ester (CHEBI:38914) |
| imetit (CHEBI:64156) is conjugate base of imetit(2+) (CHEBI:64157) |
| Incoming Relation(s) |
| imetit(2+) (CHEBI:64157) is conjugate acid of imetit (CHEBI:64156) |
| IUPAC Name |
|---|
| 2-(1H-imidazol-4-yl)ethyl carbamimidothioate |
| Synonym | Source |
|---|---|
| S-(2-(4-Imidazolyl)ethyl)isothiourea | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:880781 | Reaxys |
| CAS:102203-18-9 | KEGG COMPOUND |
| CAS:102203-18-9 | ChemIDplus |