EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N4S.2HBr |
| Net Charge | 0 |
| Average Mass | 332.065 |
| Monoisotopic Mass | 329.91494 |
| SMILES | Br.Br.N=C(N)SCCc1cncn1 |
| InChI | InChI=1S/C6H10N4S.2BrH/c7-6(8)11-2-1-5-3-9-4-10-5;;/h3-4H,1-2H2,(H3,7,8)(H,9,10);2*1H |
| InChIKey | DOBOYMKCRRLTRF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | H4-receptor agonist A histamine agonist that binds to and activates H4-receptors. H3-receptor agonist A histamine agonist that binds to and activates histamine H3-receptors. |
| Applications: | H4-receptor agonist A histamine agonist that binds to and activates H4-receptors. H3-receptor agonist A histamine agonist that binds to and activates histamine H3-receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imetit dihydrobromide (CHEBI:64151) has part imetit(2+) (CHEBI:64157) |
| imetit dihydrobromide (CHEBI:64151) has role H3-receptor agonist (CHEBI:64154) |
| imetit dihydrobromide (CHEBI:64151) has role H4-receptor agonist (CHEBI:64155) |
| imetit dihydrobromide (CHEBI:64151) is a hydrobromide (CHEBI:48367) |
| IUPAC Name |
|---|
| 2-(1H-imidazol-4-yl)ethyl carbamimidothioate dihydrobromide |
| Synonyms | Source |
|---|---|
| imetit hydrobromide | ChEBI |
| S-{2-[1H-imidazol-4-yl]ethyl}isothiourea dihydrobromide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5833853 | Reaxys |
| CAS:32385-58-3 | Reaxys |