EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30N2O.C2H2O4 |
| Net Charge | 0 |
| Average Mass | 392.496 |
| Monoisotopic Mass | 392.23112 |
| SMILES | CCCCCCCCCOc1ccc2ncc(CCN)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H30N2O.C2H2O4/c1-2-3-4-5-6-7-8-13-22-17-9-10-19-18(14-17)16(11-12-20)15-21-19;3-1(4)2(5)6/h9-10,14-15,21H,2-8,11-13,20H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JORSCLBFSAAOFR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Application: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-nonyloxytryptamine oxalate (CHEBI:64147) has part 5-nonyloxytryptaminium(1+) (CHEBI:64150) |
| 5-nonyloxytryptamine oxalate (CHEBI:64147) has role serotonergic agonist (CHEBI:35941) |
| 5-nonyloxytryptamine oxalate (CHEBI:64147) is a oxalate salt (CHEBI:64148) |
| IUPAC Name |
|---|
| 2-[5-(nonyloxy)-1H-indol-3-yl]ethanamine ethanedioate |
| Synonyms | Source |
|---|---|
| 2-[5-(nonyloxy)-1H-indol-3-yl]ethanamine oxalate | ChEBI |
| 2-[5-(nonyloxy)-1H-indol-3-yl]ethanaminium hydrogen oxalate | IUPAC |
| 3-(2-aminoethyl)-5-nonyloxyindole oxalate | ChEBI |
| O-nonylserotonin oxalate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7065207 | Reaxys |