EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16O4 |
| Net Charge | 0 |
| Average Mass | 212.245 |
| Monoisotopic Mass | 212.10486 |
| SMILES | [H][C@@]1([C@H](O)C=C)O[C@H]1/C=C/[C@@H]1O[C@@]1([H])[C@@H](C)O |
| InChI | InChI=1S/C11H16O4/c1-3-7(13)11-9(15-11)5-4-8-10(14-8)6(2)12/h3-13H,1H2,2H3/b5-4+/t6-,7-,8+,9+,10+,11+/m1/s1 |
| InChIKey | DLVJMFOLJOOWFS-INMLLLKOSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| depudecin (CHEBI:64143) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| depudecin (CHEBI:64143) has role fungal metabolite (CHEBI:76946) |
| depudecin (CHEBI:64143) is a polyketide (CHEBI:26188) |
| Incoming Relation(s) |
| depdecin (CHEBI:73749) has functional parent depudecin (CHEBI:64143) |
| IUPAC Names |
|---|
| (1R)-1-{(2S,3S)-3-[(E)-2-{(2S,3S)-3-[(1R)-1-hydroxyethyl]oxiran-2-yl}ethenyl]oxiran-2-yl}prop-2-en-1-ol |
| (1S,3E,6S)-1,2:5,6-dianhydro-3,4-dideoxy-1-[(1R)-1-hydroxyethyl]-6-[(1R)-1-hydroxyprop-2-en-1-yl]-D-threo-hex-3-enitol |
| Synonyms | Source |
|---|---|
| 4,5:8,9-dianhydro-1,2,6,7,11-pentadeoxy-D-threo-D-ido-undeca-1,6-dienitol | ChEBI |
| (−)-depudecin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6803701 | Reaxys |
| CAS:139508-73-9 | ChemIDplus |
| Citations |
|---|