EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C57H86O3 |
| Net Charge | 0 |
| Average Mass | 819.312 |
| Monoisotopic Mass | 818.65770 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C57H86O3/c1-44(2)21-12-22-45(3)23-13-24-46(4)25-14-26-47(5)27-15-28-48(6)29-16-30-49(7)31-17-32-50(8)33-18-34-51(9)35-19-36-52(10)37-20-38-53(11)39-40-54-43-55(57(59)60)41-42-56(54)58/h21,23,25,27,29,31,33,35,37,39,41-43,58H,12-20,22,24,26,28,30,32,34,36,38,40H2,1-11H3,(H,59,60)/b45-23+,46-25+,47-27+,48-29+,49-31+,50-33+,51-35+,52-37+,53-39+ |
| InChIKey | CMPNJZREBHCPHN-LTNIBBDRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-3-all-trans-decaprenylbenzoic acid (CHEBI:64136) is a monohydroxybenzoic acid (CHEBI:25389) |
| 4-hydroxy-3-all-trans-decaprenylbenzoic acid (CHEBI:64136) is a olefinic compound (CHEBI:78840) |
| 4-hydroxy-3-all-trans-decaprenylbenzoic acid (CHEBI:64136) is conjugate acid of 4-hydroxy-3-all-trans-decaprenylbenzoate (CHEBI:84503) |
| Incoming Relation(s) |
| 4-hydroxy-3-all-trans-decaprenylbenzoate (CHEBI:84503) is conjugate base of 4-hydroxy-3-all-trans-decaprenylbenzoic acid (CHEBI:64136) |
| IUPAC Name |
|---|
| 3-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26,30,34,38-decaen-1-yl]-4-hydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 3-Decaprenyl-4-hydroxybenzoate | ChemIDplus |
| 3-decaprenyl-4-hydroxybenzoic acid | ChEBI |
| Pphb-10 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:636-57-7 | ChemIDplus |
| Citations |
|---|