EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:64131 - NAN 190
| Formula | C23H27N3O3 |
| Net Charge | 0 |
| Average Mass | 393.487 |
| Monoisotopic Mass | 393.20524 |
| SMILES | COc1ccccc1N1CCN(CCCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C23H27N3O3/c1-29-21-11-5-4-10-20(21)25-16-14-24(15-17-25)12-6-7-13-26-22(27)18-8-2-3-9-19(18)23(26)28/h2-5,8-11H,6-7,12-17H2,1H3 |
| InChIKey | SJDOMIRMMUGQQK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NAN 190 (CHEBI:64131) has role serotonergic antagonist (CHEBI:48279) |
| NAN 190 (CHEBI:64131) is a N-alkylpiperazine (CHEBI:46845) |
| NAN 190 (CHEBI:64131) is a N-arylpiperazine (CHEBI:46848) |
| NAN 190 (CHEBI:64131) is a phthalimides (CHEBI:82851) |
| NAN 190 (CHEBI:64131) is conjugate base of NAN 190(1+) (CHEBI:64132) |
| Incoming Relation(s) |
| NAN 190(1+) (CHEBI:64132) is conjugate acid of NAN 190 (CHEBI:64131) |
| IUPAC Name |
|---|
| 2-{4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl}-1H-isoindole-1,3(2H)-dione |
| Synonyms | Source |
|---|---|
| NAN190 | ChEBI |
| NAN-190 | ChEBI |
| 1-(2-methoxyphenyl)-4-(4-(2-phthalimido)butyl)piperazine | ChEBI |
| Citations |
|---|