EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H11N5 |
| Net Charge | 0 |
| Average Mass | 285.310 |
| Monoisotopic Mass | 285.10145 |
| SMILES | N#Cc1ccc(C(c2ccc(C#N)cc2)n2cncn2)cc1 |
| InChI | InChI=1S/C17H11N5/c18-9-13-1-5-15(6-2-13)17(22-12-20-11-21-22)16-7-3-14(10-19)4-8-16/h1-8,11-12,17H |
| InChIKey | HPJKCIUCZWXJDR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| letrozole (CHEBI:6413) has role antineoplastic agent (CHEBI:35610) |
| letrozole (CHEBI:6413) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| letrozole (CHEBI:6413) is a nitrile (CHEBI:18379) |
| letrozole (CHEBI:6413) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 4,4'-(1H-1,2,4-triazol-1-ylmethanediyl)dibenzonitrile |
| INN | Source |
|---|---|
| letrozole | DrugBank |
| Synonyms | Source |
|---|---|
| Letrozol | DrugBank |
| Letrozole | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Femara | DrugBank |