EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N5O4 |
| Net Charge | 0 |
| Average Mass | 293.283 |
| Monoisotopic Mass | 293.11240 |
| SMILES | Nc1nc(=O)c2c(CN[C@@H]3[C@@H](O)[C@@H](O)[C@@H]4O[C@H]34)cnc2n1 |
| InChI | InChI=1S/C12H15N5O4/c13-12-16-10-4(11(20)17-12)3(2-15-10)1-14-5-6(18)7(19)9-8(5)21-9/h2,5-9,14,18-19H,1H2,(H4,13,15,16,17,20)/t5-,6-,7-,8-,9+/m1/s1 |
| InChIKey | JSGKREWPBLKPCZ-OKNNCHMLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epoxyqueuine (CHEBI:64129) has functional parent queuine (CHEBI:17433) |
| epoxyqueuine (CHEBI:64129) is a epoxide (CHEBI:32955) |
| epoxyqueuine (CHEBI:64129) is a pyrrolopyrimidine (CHEBI:38670) |
| epoxyqueuine (CHEBI:64129) is conjugate base of epoxyqueuine(1+) (CHEBI:77675) |
| Incoming Relation(s) |
| epoxyqueuine(1+) (CHEBI:77675) is conjugate acid of epoxyqueuine (CHEBI:64129) |
| IUPAC Name |
|---|
| 2-amino-5-({[(1R,2R,3R,4R,5S)-3,4-dihydroxy-6-oxabicyclo[3.1.0]hex-2-yl]amino}methyl)-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one |
| Synonym | Source |
|---|---|
| 7-(5-[(3,4-epoxy-2,5-dihydroxycyclopent-1-yl)amino]methyl)-7-deazaguanine | ChEBI |
| Citations |
|---|