EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N3O3.HBr |
| Net Charge | 0 |
| Average Mass | 474.399 |
| Monoisotopic Mass | 473.13140 |
| SMILES | Br.COc1ccccc1N1CCN(CCCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C23H27N3O3.BrH/c1-29-21-11-5-4-10-20(21)25-16-14-24(15-17-25)12-6-7-13-26-22(27)18-8-2-3-9-19(18)23(26)28;/h2-5,8-11H,6-7,12-17H2,1H3;1H |
| InChIKey | AXRUEPFPTQYHQD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NAN 190 hydrobromide (CHEBI:64123) has part NAN 190(1+) (CHEBI:64132) |
| NAN 190 hydrobromide (CHEBI:64123) has role serotonergic antagonist (CHEBI:48279) |
| NAN 190 hydrobromide (CHEBI:64123) is a hydrobromide (CHEBI:48367) |
| IUPAC Name |
|---|
| 2-{4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl}-1H-isoindole-1,3(2H)-dione hydrobromide |
| Synonyms | Source |
|---|---|
| 1-(2-Methoxyphenyl)-4-(4-(2-phthalimido)butyl)piperazine hydrobromide | ChemIDplus |
| 1-[4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)butyl]-4-(2-methoxyphenyl)piperazin-1-ium bromide | IUPAC |
| Nan 190 | ChemIDplus |
| NAN190 hydrobromide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4775818 | Reaxys |
| CAS:115338-32-4 | ChemIDplus |