EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1c(O)ccc2c1O/C(=C\c1ccc(O)c(O)c1)C2=O |
| InChI | InChI=1S/C16H12O6/c1-21-16-11(18)5-3-9-14(20)13(22-15(9)16)7-8-2-4-10(17)12(19)6-8/h2-7,17-19H,1H3/b13-7- |
| InChIKey | PFRGTMTYWMVLMU-QPEQYQDCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coreopsis lanceolata (ncbitaxon:159666) | - | PubMed (24236492) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leptosidin (CHEBI:6412) has functional parent aurone (CHEBI:47964) |
| leptosidin (CHEBI:6412) has role plant metabolite (CHEBI:76924) |
| leptosidin (CHEBI:6412) is a catechols (CHEBI:33566) |
| leptosidin (CHEBI:6412) is a hydroxyaurone (CHEBI:85970) |
| leptosidin (CHEBI:6412) is a methoxyaurone (CHEBI:85967) |
| IUPAC Name |
|---|
| (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-7-methoxy-1-benzofuran-3(2H)-one |
| Manual Xrefs | Databases |
|---|---|
| C08651 | KEGG COMPOUND |
| C00008030 | KNApSAcK |
| LMPK12130021 | LIPID MAPS |
| Leptosidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:36756 | Reaxys |
| CAS:486-24-8 | KEGG COMPOUND |
| CAS:486-24-8 | ChemIDplus |
| Citations |
|---|