EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23NO |
| Net Charge | 0 |
| Average Mass | 233.355 |
| Monoisotopic Mass | 233.17796 |
| SMILES | CCCN[C@@H]1CCc2c(OC)cccc2[C@@H]1C |
| InChI | InChI=1S/C15H23NO/c1-4-10-16-14-9-8-13-12(11(14)2)6-5-7-15(13)17-3/h5-7,11,14,16H,4,8-10H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | YGHLYBIUVOLKCV-SMDDNHRTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Application: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R)-5-methoxy-1-methyl-2-(propylamino)tetralin (CHEBI:64117) has parent hydride tetralin (CHEBI:35008) |
| (1S,2R)-5-methoxy-1-methyl-2-(propylamino)tetralin (CHEBI:64117) has role dopaminergic antagonist (CHEBI:48561) |
| (1S,2R)-5-methoxy-1-methyl-2-(propylamino)tetralin (CHEBI:64117) is a secondary amino compound (CHEBI:50995) |
| (1S,2R)-5-methoxy-1-methyl-2-(propylamino)tetralin (CHEBI:64117) is a tetralins (CHEBI:36786) |
| (1S,2R)-5-methoxy-1-methyl-2-(propylamino)tetralin (CHEBI:64117) is conjugate base of (1S,2R)-5-methoxy-1-methyl-2-(propylammonio)tetralin(1+) (CHEBI:64118) |
| Incoming Relation(s) |
| (1S,2R)-5-methoxy-1-methyl-2-(propylammonio)tetralin(1+) (CHEBI:64118) is conjugate acid of (1S,2R)-5-methoxy-1-methyl-2-(propylamino)tetralin (CHEBI:64117) |
| IUPAC Name |
|---|
| (1S,2R)-5-methoxy-1-methyl-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| Synonyms | Source |
|---|---|
| 5-Methoxy-1-methyl-2-(n-propylamino)tetralin | ChemIDplus |
| (+)-AJ 76 | ChEBI |
| AJ 76 | ChemIDplus |
| AJ-76 | ChemIDplus |
| cis-(+)-5-methoxy-1-methyl-2-(propylamino)tetralin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-25635 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4745495 | Reaxys |
| CAS:85379-09-5 | ChemIDplus |
| Citations |
|---|