EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H31N5O3.HCl |
| Net Charge | 0 |
| Average Mass | 534.060 |
| Monoisotopic Mass | 533.21937 |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3ccc(-c4noc(C)n4)cc3C)cc2)cc1N1CCN(C)CC1.Cl |
| InChI | InChI=1S/C29H31N5O3.ClH/c1-19-17-23(28-30-20(2)37-32-28)9-11-25(19)21-5-7-22(8-6-21)29(35)31-24-10-12-27(36-4)26(18-24)34-15-13-33(3)14-16-34;/h5-12,17-18H,13-16H2,1-4H3,(H,31,35);1H |
| InChIKey | SRVVUYIJVBLEJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GR 127935 hydrochloride (CHEBI:64111) has part GR 127935(1+) (CHEBI:64113) |
| GR 127935 hydrochloride (CHEBI:64111) has role serotonergic antagonist (CHEBI:48279) |
| GR 127935 hydrochloride (CHEBI:64111) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)biphenyl-4-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| GR127935 hydrochloride | ChEBI |
| 4-[2-methoxy-5-({[2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]carbonyl}amino)phenyl]-1-methylpiperazin-1-ium chloride | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8530522 | Reaxys |