EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O2.Na |
| Net Charge | 0 |
| Average Mass | 110.088 |
| Monoisotopic Mass | 110.03437 |
| SMILES | CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H8O2.Na/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | MFBOGIVSZKQAPD-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium butyrate (CHEBI:64103) has part butyrate (CHEBI:17968) |
| sodium butyrate (CHEBI:64103) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| sodium butyrate (CHEBI:64103) has role geroprotector (CHEBI:176497) |
| sodium butyrate (CHEBI:64103) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium butanoate |
| Synonyms | Source |
|---|---|
| Butyric acid, sodium salt | ChemIDplus |
| Butanoic acid, sodium salt | ChemIDplus |
| Butanoic acid, sodium salt (1:1) | ChemIDplus |
| Butyric acid sodium salt | ChemIDplus |
| Butyrate sodium | ChemIDplus |
| Sodium n-butyrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Sodium_butyrate | Wikipedia |
| D08998 | KEGG DRUG |
| DBSALT002877 | DrugBank |
| Citations |
|---|