EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O2.Na |
| Net Charge | 0 |
| Average Mass | 110.088 |
| Monoisotopic Mass | 110.03437 |
| SMILES | CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H8O2.Na/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | MFBOGIVSZKQAPD-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium butyrate (CHEBI:64103) has part butyrate (CHEBI:17968) |
| sodium butyrate (CHEBI:64103) has role antihypertensive agent (CHEBI:35674) |
| sodium butyrate (CHEBI:64103) has role antirheumatic drug (CHEBI:35842) |
| sodium butyrate (CHEBI:64103) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| sodium butyrate (CHEBI:64103) has role geroprotector (CHEBI:176497) |
| sodium butyrate (CHEBI:64103) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium butanoate |
| Synonyms | Source |
|---|---|
| Butanoic acid, sodium salt | ChemIDplus |
| Butanoic acid, sodium salt (1:1) | ChemIDplus |
| Butyrate sodium | ChemIDplus |
| Butyric acid sodium salt | ChemIDplus |
| Butyric acid, sodium salt | ChemIDplus |
| NSC-174280 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D08998 | KEGG DRUG |
| DBSALT002877 | DrugBank |
| Sodium_butyrate | Wikipedia |
| Citations |
|---|