EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26FN3O2.HCl |
| Net Charge | 0 |
| Average Mass | 443.950 |
| Monoisotopic Mass | 443.17758 |
| SMILES | COc1ccc2cccc(N3CCN(CCNC(=O)c4ccc(F)cc4)CC3)c2c1.Cl |
| InChI | InChI=1S/C24H26FN3O2.ClH/c1-30-21-10-7-18-3-2-4-23(22(18)17-21)28-15-13-27(14-16-28)12-11-26-24(29)19-5-8-20(25)9-6-19;/h2-10,17H,11-16H2,1H3,(H,26,29);1H |
| InChIKey | HWLZKPKZVOLFGK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-fluoro-N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}benzamide hydrochloride (CHEBI:64099) has part 4-fluoro-N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}benzamide(1+) (CHEBI:64100) |
| 4-fluoro-N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}benzamide hydrochloride (CHEBI:64099) has role anxiolytic drug (CHEBI:35474) |
| 4-fluoro-N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}benzamide hydrochloride (CHEBI:64099) has role serotonergic agonist (CHEBI:35941) |
| 4-fluoro-N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}benzamide hydrochloride (CHEBI:64099) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-fluoro-N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}benzamide hydrochloride |
| Synonyms | Source |
|---|---|
| 1-((4-Fluorobenzoylamino)ethyl)-4-(7-methoxy-1-naphthyl)piperazine hydrochloride | ChemIDplus |
| S 14506 | ChemIDplus |
| S-14506 | ChemIDplus |
| S 14506 hydrochloride | ChEBI |
| S14506 hydrochloride | ChEBI |
| S 14506 monohydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8374093 | Reaxys |
| CAS:135721-98-1 | ChemIDplus |
| Citations |
|---|