EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N2O |
| Net Charge | 0 |
| Average Mass | 414.593 |
| Monoisotopic Mass | 414.26711 |
| SMILES | c1ccc(CCCN2CCN(CCOC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H34N2O/c1-4-11-25(12-5-1)13-10-18-29-19-21-30(22-20-29)23-24-31-28(26-14-6-2-7-15-26)27-16-8-3-9-17-27/h1-9,11-12,14-17,28H,10,13,18-24H2 |
| InChIKey | RAQPOZGWANIDQT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine (CHEBI:64093) has role dopamine uptake inhibitor (CHEBI:51039) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine (CHEBI:64093) is a N-alkylpiperazine (CHEBI:46845) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine (CHEBI:64093) is a ether (CHEBI:25698) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine (CHEBI:64093) is a tertiary amino compound (CHEBI:50996) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine (CHEBI:64093) is conjugate base of 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazinediium(2+) (CHEBI:64092) |
| Incoming Relation(s) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazinediium(2+) (CHEBI:64092) is conjugate acid of 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine (CHEBI:64093) |
| IUPAC Name |
|---|
| 1-[2-(diphenylmethoxy)ethyl]-4-(3-phenylpropyl)piperazine |
| Synonyms | Source |
|---|---|
| Gbr 12935 | ChemIDplus |
| GBR 12935 | ChEBI |
| GBR12935 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:578614 | Reaxys |
| CAS:76778-22-8 | ChemIDplus |
| Citations |
|---|