EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N2O.2HCl |
| Net Charge | 0 |
| Average Mass | 487.515 |
| Monoisotopic Mass | 486.22047 |
| SMILES | Cl.Cl.c1ccc(CCCN2CCN(CCOC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H34N2O.2ClH/c1-4-11-25(12-5-1)13-10-18-29-19-21-30(22-20-29)23-24-31-28(26-14-6-2-7-15-26)27-16-8-3-9-17-27;;/h1-9,11-12,14-17,28H,10,13,18-24H2;2*1H |
| InChIKey | NQWRSILGEXNJIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine dihydrochloride (CHEBI:64091) has part 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazinediium(2+) (CHEBI:64092) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine dihydrochloride (CHEBI:64091) has role dopamine uptake inhibitor (CHEBI:51039) |
| 1-[2-(benzhydryloxy)ethyl]-4-(3-phenylpropyl)piperazine dihydrochloride (CHEBI:64091) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-[2-(diphenylmethoxy)ethyl]-4-(3-phenylpropyl)piperazine dihydrochloride |
| Synonyms | Source |
|---|---|
| 1-[2-(diphenylmethoxy)ethyl]-4-(3-phenylpropyl)piperazinediium dichloride | IUPAC |
| GBR 12935 dihydrochloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US4202896 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5689635 | Reaxys |
| Citations |
|---|