EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32F2N2O |
| Net Charge | 0 |
| Average Mass | 450.573 |
| Monoisotopic Mass | 450.24827 |
| SMILES | Fc1ccc(C(OCCN2CCN(CCCc3ccccc3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H32F2N2O/c29-26-12-8-24(9-13-26)28(25-10-14-27(30)15-11-25)33-22-21-32-19-17-31(18-20-32)16-4-7-23-5-2-1-3-6-23/h1-3,5-6,8-15,28H,4,7,16-22H2 |
| InChIKey | NAUWTFJOPJWYOT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanoxerine (CHEBI:64089) has role dopamine uptake inhibitor (CHEBI:51039) |
| vanoxerine (CHEBI:64089) is a N-alkylpiperazine (CHEBI:46845) |
| vanoxerine (CHEBI:64089) is a ether (CHEBI:25698) |
| vanoxerine (CHEBI:64089) is a organofluorine compound (CHEBI:37143) |
| vanoxerine (CHEBI:64089) is a tertiary amino compound (CHEBI:50996) |
| vanoxerine (CHEBI:64089) is conjugate base of vanoxerine(2+) (CHEBI:64087) |
| Incoming Relation(s) |
| vanoxerine(2+) (CHEBI:64087) is conjugate acid of vanoxerine (CHEBI:64089) |
| IUPAC Name |
|---|
| 1-{2-[bis(4-fluorophenyl)methoxy]ethyl}-4-(3-phenylpropyl)piperazine |
| INNs | Source |
|---|---|
| vanoxerina | ChemIDplus |
| vanoxerinum | ChemIDplus |
| vanoxerine | ChemIDplus |
| Synonyms | Source |
|---|---|
| GBR12909 | ChEBI |
| GBR 12909 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Vanoxerine | Wikipedia |
| LSM-2703 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:587912 | Reaxys |
| CAS:67469-69-6 | ChemIDplus |
| Citations |
|---|