EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32F2N2O.2HCl |
| Net Charge | 0 |
| Average Mass | 523.495 |
| Monoisotopic Mass | 522.20163 |
| SMILES | Cl.Cl.Fc1ccc(C(OCCN2CCN(CCCc3ccccc3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H32F2N2O.2ClH/c29-26-12-8-24(9-13-26)28(25-10-14-27(30)15-11-25)33-22-21-32-19-17-31(18-20-32)16-4-7-23-5-2-1-3-6-23;;/h1-3,5-6,8-15,28H,4,7,16-22H2;2*1H |
| InChIKey | MIBSKSYCRFWIRU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanoxerine dihydrochloride (CHEBI:64086) has part vanoxerine(2+) (CHEBI:64087) |
| vanoxerine dihydrochloride (CHEBI:64086) has role dopamine uptake inhibitor (CHEBI:51039) |
| vanoxerine dihydrochloride (CHEBI:64086) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-{2-[bis(4-fluorophenyl)methoxy]ethyl}-4-(3-phenylpropyl)piperazine dihydrochloride |
| Synonyms | Source |
|---|---|
| 1-{2-[bis(4-fluorophenyl)methoxy]ethyl}-4-(3-phenylpropyl)piperazinediium dichloride | IUPAC |
| GBR 12909 dihydrochloride | ChEBI |
| GBR12909 dihydrochloride | ChEBI |
| Vanoxerine hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5696321 | Reaxys |
| CAS:67469-78-7 | ChemIDplus |
| Citations |
|---|