EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36ClN3O6S |
| Net Charge | 0 |
| Average Mass | 554.109 |
| Monoisotopic Mass | 553.20133 |
| SMILES | COc1cc(COc2cc(N)c(Cl)cc2C(=O)CCC2CCN(CCNS(C)(=O)=O)CC2)cc(OC)c1 |
| InChI | InChI=1S/C26H36ClN3O6S/c1-34-20-12-19(13-21(14-20)35-2)17-36-26-16-24(28)23(27)15-22(26)25(31)5-4-18-6-9-30(10-7-18)11-8-29-37(3,32)33/h12-16,18,29H,4-11,17,28H2,1-3H3 |
| InChIKey | BKVIWGRFRKLFIO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RS 39604 (CHEBI:64083) has role serotonergic antagonist (CHEBI:48279) |
| RS 39604 (CHEBI:64083) is a aromatic ether (CHEBI:35618) |
| RS 39604 (CHEBI:64083) is a aromatic ketone (CHEBI:76224) |
| RS 39604 (CHEBI:64083) is a monochlorobenzenes (CHEBI:83403) |
| RS 39604 (CHEBI:64083) is a piperidines (CHEBI:26151) |
| RS 39604 (CHEBI:64083) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| RS-67506 | ChEBI |
| RS67506 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-2461 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8524141 | Reaxys |
| Citations |
|---|