EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36ClN3O6S.HCl |
| Net Charge | 0 |
| Average Mass | 590.570 |
| Monoisotopic Mass | 589.17801 |
| SMILES | COc1cc(COc2cc(N)c(Cl)cc2C(=O)CCC2CCN(CCNS(C)(=O)=O)CC2)cc(OC)c1.Cl |
| InChI | InChI=1S/C26H36ClN3O6S.ClH/c1-34-20-12-19(13-21(14-20)35-2)17-36-26-16-24(28)23(27)15-22(26)25(31)5-4-18-6-9-30(10-7-18)11-8-29-37(3,32)33;/h12-16,18,29H,4-11,17,28H2,1-3H3;1H |
| InChIKey | QSMYZGMJSGUWPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RS 39604 hydrochloride (CHEBI:64081) has part RS 39604(1+) (CHEBI:64082) |
| RS 39604 hydrochloride (CHEBI:64081) has role serotonergic antagonist (CHEBI:48279) |
| RS 39604 hydrochloride (CHEBI:64081) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-{2-[4-(3-{4-amino-5-chloro-2-[(3,5-dimethoxybenzyl)oxy]phenyl}-3-oxopropyl)piperidin-1-yl]ethyl}methanesulfonamide hydrochloride |
| Synonyms | Source |
|---|---|
| RS-67506 | ChemIDplus |
| RS67506 | ChemIDplus |
| RS 67506 | ChemIDplus |
| 1-(4-Amino-5-chloro-2-methoxyphenyl)-3-(1-(2-methylsulphonylamino)ethyl-4-piperidinyl)-1-propanone hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8889150 | Reaxys |
| CAS:168986-61-6 | ChemIDplus |