EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO3 |
| Net Charge | 0 |
| Average Mass | 329.440 |
| Monoisotopic Mass | 329.19909 |
| SMILES | NC[C@@H]1O[C@H](C23CC4CC(CC(C4)C2)C3)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C20H27NO3/c21-10-17-14-1-2-16(22)19(23)15(14)6-18(24-17)20-7-11-3-12(8-20)5-13(4-11)9-20/h1-2,11-13,17-18,22-23H,3-10,21H2/t11?,12?,13?,17-,18-,20?/m0/s1 |
| InChIKey | QLJOSZATCBCBDR-DFKUFRTHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydroisochromene-5,6-diol (CHEBI:64080) has role antiparkinson drug (CHEBI:48407) |
| (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydroisochromene-5,6-diol (CHEBI:64080) has role dopamine agonist (CHEBI:51065) |
| (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydroisochromene-5,6-diol (CHEBI:64080) is a adamantanes (CHEBI:51339) |
| (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydroisochromene-5,6-diol (CHEBI:64080) is a catechols (CHEBI:33566) |
| (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydroisochromene-5,6-diol (CHEBI:64080) is a isochromenes (CHEBI:38761) |
| (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydroisochromene-5,6-diol (CHEBI:64080) is a primary amino compound (CHEBI:50994) |
| (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydroisochromene-5,6-diol (CHEBI:64080) is conjugate base of (1R,3S)-3-(adamantan-1-yl)-1-(ammoniomethyl)-3,4-dihydroisochromene-5,6-diol(1+) (CHEBI:64079) |
| Incoming Relation(s) |
| (1R,3S)-3-(adamantan-1-yl)-1-(ammoniomethyl)-3,4-dihydroisochromene-5,6-diol(1+) (CHEBI:64079) is conjugate acid of (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydroisochromene-5,6-diol (CHEBI:64080) |
| IUPAC Name |
|---|
| (1R,3S)-3-(adamantan-1-yl)-1-(aminomethyl)-3,4-dihydro-1H-isochromene-5,6-diol |
| Synonyms | Source |
|---|---|
| A 77636 | ChEBI |
| A-77636 | ChEBI |
| A77636 | ChEBI |