EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6407 - lenacil
| Formula | C13H18N2O2 |
| Net Charge | 0 |
| Average Mass | 234.299 |
| Monoisotopic Mass | 234.13683 |
| SMILES | O=c1nc2c(c(=O)n1C1CCCCC1)CCC2 |
| InChI | InChI=1S/C13H18N2O2/c16-12-10-7-4-8-11(10)14-13(17)15(12)9-5-2-1-3-6-9/h9H,1-8H2,(H,14,17) |
| InChIKey | ZTMKADLOSYKWCA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lenacil (CHEBI:6407) has role agrochemical (CHEBI:33286) |
| lenacil (CHEBI:6407) has role environmental contaminant (CHEBI:78298) |
| lenacil (CHEBI:6407) has role herbicide (CHEBI:24527) |
| lenacil (CHEBI:6407) has role xenobiotic (CHEBI:35703) |
| lenacil (CHEBI:6407) is a cyclopentapyrimidine (CHEBI:48437) |
| IUPAC Name |
|---|
| 3-cyclohexyl-6,7-dihydro-1H-cyclopenta[d]pyrimidine-2,4(3H,5H)-dione |
| Synonyms | Source |
|---|---|
| 3-cyclohexyl-5,6-trimethyleneuracil | ChEBI |
| 3-cyclohexyl-1,5,6,7-tetrahydrocyclopentapyrimidine-2,4(3H)-dione | Alan Wood's Pesticides |
| Citations |
|---|