EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32N4O3 |
| Net Charge | 0 |
| Average Mass | 520.633 |
| Monoisotopic Mass | 520.24744 |
| SMILES | Cc1nc(-c2ccc(-c3ccc(C(=O)N4CCc5cc6c(cc54)C4(CCN(C)CC4)CO6)cc3)c(C)c2)no1 |
| InChI | InChI=1S/C32H32N4O3/c1-20-16-25(30-33-21(2)39-34-30)8-9-26(20)22-4-6-23(7-5-22)31(37)36-13-10-24-17-29-27(18-28(24)36)32(19-38-29)11-14-35(3)15-12-32/h4-9,16-18H,10-15,19H2,1-3H3 |
| InChIKey | ATQMRMGXINTJHV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB 224289 (CHEBI:64069) has role serotonergic antagonist (CHEBI:48279) |
| SB 224289 (CHEBI:64069) is a 1,2,4-oxadiazole (CHEBI:46809) |
| SB 224289 (CHEBI:64069) is a azaspiro compound (CHEBI:35624) |
| SB 224289 (CHEBI:64069) is a benzamides (CHEBI:22702) |
| SB 224289 (CHEBI:64069) is a organic heterotetracyclic compound (CHEBI:38163) |
| SB 224289 (CHEBI:64069) is conjugate base of SB 224289(1+) (CHEBI:64071) |
| Incoming Relation(s) |
| SB 224289(1+) (CHEBI:64071) is conjugate acid of SB 224289 (CHEBI:64069) |
| IUPAC Name |
|---|
| (1'-methyl-6,7-dihydro-5H-spiro[furo[2,3-f]indole-3,4'-piperidin]-5-yl)[2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methanone |
| Synonym | Source |
|---|---|
| SB224289 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US5972951 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:180083-23-2 | Reaxys |
| Citations |
|---|