EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32N4O3.HCl |
| Net Charge | 0 |
| Average Mass | 557.094 |
| Monoisotopic Mass | 556.22412 |
| SMILES | Cc1nc(-c2ccc(-c3ccc(C(=O)N4CCc5cc6c(cc54)C4(CCN(C)CC4)CO6)cc3)c(C)c2)no1.Cl |
| InChI | InChI=1S/C32H32N4O3.ClH/c1-20-16-25(30-33-21(2)39-34-30)8-9-26(20)22-4-6-23(7-5-22)31(37)36-13-10-24-17-29-27(18-28(24)36)32(19-38-29)11-14-35(3)15-12-32;/h4-9,16-18H,10-15,19H2,1-3H3;1H |
| InChIKey | GKGKBZYMDILCOF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB 224289 hydrochloride (CHEBI:64067) has part SB 224289(1+) (CHEBI:64071) |
| SB 224289 hydrochloride (CHEBI:64067) has role prodrug (CHEBI:50266) |
| SB 224289 hydrochloride (CHEBI:64067) has role serotonergic antagonist (CHEBI:48279) |
| SB 224289 hydrochloride (CHEBI:64067) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| (1'-methyl-6,7-dihydro-5H-spiro[furo[2,3-f]indole-3,4'-piperidin]-5-yl)[2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methanone hydrochloride |
| 1'-methyl-5-{[2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]carbonyl}-6,7-dihydro-5H-spiro[furo[2,3-f]indole-3,4'-piperidinium] chloride |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8248456 | Reaxys |
| Citations |
|---|