EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27ClN2O |
| Net Charge | 0 |
| Average Mass | 406.957 |
| Monoisotopic Mass | 406.18119 |
| SMILES | OC(CN1CCN(c2cccc(Cl)c2)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27ClN2O/c26-22-12-7-13-23(18-22)28-16-14-27(15-17-28)19-24(29)25(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,18,24-25,29H,14-17,19H2 |
| InChIKey | QJHCTHPYUOXOGM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol (CHEBI:64060) has role geroprotector (CHEBI:176497) |
| 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol (CHEBI:64060) has role serotonergic antagonist (CHEBI:48279) |
| 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol (CHEBI:64060) is a N-alkylpiperazine (CHEBI:46845) |
| 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol (CHEBI:64060) is a N-arylpiperazine (CHEBI:46848) |
| 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol (CHEBI:64060) is a monochlorobenzenes (CHEBI:83403) |
| 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol (CHEBI:64060) is a secondary alcohol (CHEBI:35681) |
| 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol (CHEBI:64060) is conjugate base of 4-(3-chlorophenyl)-1-(2-hydroxy-3,3-diphenylpropyl)piperazin-1-ium(1+) (CHEBI:64059) |
| Incoming Relation(s) |
| 4-(3-chlorophenyl)-1-(2-hydroxy-3,3-diphenylpropyl)piperazin-1-ium(1+) (CHEBI:64059) is conjugate acid of 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol (CHEBI:64060) |
| IUPAC Name |
|---|
| 3-[4-(3-chlorophenyl)piperazin-1-yl]-1,1-diphenylpropan-2-ol |
| Synonyms | Source |
|---|---|
| 1-(diphenylmethyl)-2-(4-(3-chlorophenyl)-1-piperazinyl)ethanol | ChemIDplus |
| 3-(4-(3-chlorophenyl)-1-piperazinyl)-1,1-diphenyl-2-propanol | ChemIDplus |
| 3-(4-(3-chlorophenyl)piperazin-1-yl)-1,1,-diphenyl-2-propanol | ChemIDplus |
| BRL 15572 | ChEBI |
| BRL-15,572 | ChemIDplus |
| BRL-15572 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9004321 | Reaxys |
| CAS:734517-40-9 | ChemIDplus |
| Citations |
|---|