EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN4 |
| Net Charge | 0 |
| Average Mass | 312.804 |
| Monoisotopic Mass | 312.11417 |
| SMILES | Clc1ccc2c(c1)N=C(N1CCNCC1)c1ccccc1N2 |
| InChI | InChI=1S/C17H17ClN4/c18-12-5-6-15-16(11-12)21-17(22-9-7-19-8-10-22)13-3-1-2-4-14(13)20-15/h1-6,11,19-20H,7-10H2 |
| InChIKey | JNNOSTQEZICQQP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-desmethylclozapine (CHEBI:64050) has role metabolite (CHEBI:25212) |
| N-desmethylclozapine (CHEBI:64050) has role serotonergic antagonist (CHEBI:48279) |
| N-desmethylclozapine (CHEBI:64050) has role δ-opioid receptor agonist (CHEBI:64054) |
| N-desmethylclozapine (CHEBI:64050) is a dibenzodiazepine (CHEBI:64051) |
| N-desmethylclozapine (CHEBI:64050) is a organochlorine compound (CHEBI:36683) |
| N-desmethylclozapine (CHEBI:64050) is a piperazines (CHEBI:26144) |
| IUPAC Name |
|---|
| 8-chloro-11-(piperazin-1-yl)-5H-dibenzo[b,e][1,4]diazepine |
| Synonyms | Source |
|---|---|
| 8-Chloro-11-(1-piperazinyl)-5H-dibenzo(b,e)(1,4)diazepine | ChemIDplus |
| Demethylclozapine | ChemIDplus |
| Desmethylclozapine | ChemIDplus |
| N-desmethyl clozapine | ChEBI |
| NDMC | ChEBI |
| Norclozapine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Desmethylclozapine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:762289 | Reaxys |
| CAS:6104-71-8 | ChemIDplus |
| Citations |
|---|