EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN4 |
| Net Charge | 0 |
| Average Mass | 312.804 |
| Monoisotopic Mass | 312.11417 |
| SMILES | Clc1ccc2c(c1)N=C(N1CCNCC1)c1ccccc1N2 |
| InChI | InChI=1S/C17H17ClN4/c18-12-5-6-15-16(11-12)21-17(22-9-7-19-8-10-22)13-3-1-2-4-14(13)20-15/h1-6,11,19-20H,7-10H2 |
| InChIKey | JNNOSTQEZICQQP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-desmethylclozapine (CHEBI:64050) has role metabolite (CHEBI:25212) |
| N-desmethylclozapine (CHEBI:64050) has role serotonergic antagonist (CHEBI:48279) |
| N-desmethylclozapine (CHEBI:64050) has role δ-opioid receptor agonist (CHEBI:64054) |
| N-desmethylclozapine (CHEBI:64050) is a dibenzodiazepine (CHEBI:64051) |
| N-desmethylclozapine (CHEBI:64050) is a organochlorine compound (CHEBI:36683) |
| N-desmethylclozapine (CHEBI:64050) is a piperazines (CHEBI:26144) |
| IUPAC Name |
|---|
| 8-chloro-11-(piperazin-1-yl)-5H-dibenzo[b,e][1,4]diazepine |
| Synonyms | Source |
|---|---|
| 8-Chloro-11-(1-piperazinyl)-5H-dibenzo(b,e)(1,4)diazepine | ChemIDplus |
| Demethylclozapine | ChemIDplus |
| Desmethylclozapine | ChemIDplus |
| N-desmethyl clozapine | ChEBI |
| NDMC | ChEBI |
| Norclozapine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Desmethylclozapine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:762289 | Reaxys |
| CAS:6104-71-8 | ChemIDplus |
| Citations |
|---|