EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27N3O4S |
| Net Charge | 0 |
| Average Mass | 369.487 |
| Monoisotopic Mass | 369.17223 |
| SMILES | CCN1CCCC1CNC(=O)c1cc(S(=O)(=O)CC)c(N)cc1OC |
| InChI | InChI=1S/C17H27N3O4S/c1-4-20-8-6-7-12(20)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3/h9-10,12H,4-8,11,18H2,1-3H3,(H,19,21) |
| InChIKey | NTJOBXMMWNYJFB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amisulpride (CHEBI:64045) has role environmental contaminant (CHEBI:78298) |
| amisulpride (CHEBI:64045) has role second generation antipsychotic (CHEBI:65191) |
| amisulpride (CHEBI:64045) has role xenobiotic (CHEBI:35703) |
| amisulpride (CHEBI:64045) is a aromatic amide (CHEBI:62733) |
| amisulpride (CHEBI:64045) is a aromatic amine (CHEBI:33860) |
| amisulpride (CHEBI:64045) is a benzamides (CHEBI:22702) |
| amisulpride (CHEBI:64045) is a pyrrolidines (CHEBI:38260) |
| amisulpride (CHEBI:64045) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-(ethylsulfonyl)-2-methoxybenzamide |
| INNs | Source |
|---|---|
| amisulpride | KEGG DRUG |
| amisulprida | ChemIDplus |
| amisulpridum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Aminosultopride | DrugBank |
| 4-Amino-N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(ethylsulfonyl)-2-methoxybenzamide | ChemIDplus |
| 4-Amino-N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(ethylsulfonyl)-o-anisamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07310 | KEGG DRUG |
| DB06288 | DrugBank |
| Amisulpride | Wikipedia |
| BE872585 | Patent |
| US4401822 | Patent |
| HMDB0015633 | HMDB |
| LSM-1669 | LINCS |
| 179 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6876191 | Reaxys |
| CAS:71675-85-9 | ChemIDplus |
| Citations |
|---|