EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27N3O4S |
| Net Charge | 0 |
| Average Mass | 369.487 |
| Monoisotopic Mass | 369.17223 |
| SMILES | CCN1CCCC1CNC(=O)c1cc(S(=O)(=O)CC)c(N)cc1OC |
| InChI | InChI=1S/C17H27N3O4S/c1-4-20-8-6-7-12(20)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3/h9-10,12H,4-8,11,18H2,1-3H3,(H,19,21) |
| InChIKey | NTJOBXMMWNYJFB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. appetite enhancer A drug which increases appetite. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amisulpride (CHEBI:64045) has role antidepressant (CHEBI:35469) |
| amisulpride (CHEBI:64045) has role antiemetic (CHEBI:50919) |
| amisulpride (CHEBI:64045) has role anxiolytic drug (CHEBI:35474) |
| amisulpride (CHEBI:64045) has role appetite enhancer (CHEBI:50779) |
| amisulpride (CHEBI:64045) has role environmental contaminant (CHEBI:78298) |
| amisulpride (CHEBI:64045) has role second generation antipsychotic (CHEBI:65191) |
| amisulpride (CHEBI:64045) has role xenobiotic (CHEBI:35703) |
| amisulpride (CHEBI:64045) is a aromatic amide (CHEBI:62733) |
| amisulpride (CHEBI:64045) is a aromatic amine (CHEBI:33860) |
| amisulpride (CHEBI:64045) is a benzamides (CHEBI:22702) |
| amisulpride (CHEBI:64045) is a pyrrolidines (CHEBI:38260) |
| amisulpride (CHEBI:64045) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-(ethylsulfonyl)-2-methoxybenzamide |
| INNs | Source |
|---|---|
| amisulprida | ChemIDplus |
| amisulpride | KEGG DRUG |
| amisulpridum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Amino-N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(ethylsulfonyl)-2-methoxybenzamide | ChemIDplus |
| 4-Amino-N-((1-ethyl-2-pyrrolidinyl)methyl)-5-(ethylsulfonyl)-o-anisamide | ChemIDplus |
| Aminosultopride | DrugBank |
| APD-421 | ChEMBL |
| APD421 | ChEMBL |
| DAN-2163 | ChEMBL |
| Brand Names | Source |
|---|---|
| Barhemsys | ChEMBL |
| Solian 100 | ChEMBL |
| Solian 200 | ChEMBL |
| Solian 400 | ChEMBL |
| Solian 50 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 179 | DrugCentral |
| Amisulpride | Wikipedia |
| BE872585 | Patent |
| D07310 | KEGG DRUG |
| DB06288 | DrugBank |
| HMDB0015633 | HMDB |
| LSM-1669 | LINCS |
| US4401822 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6876191 | Reaxys |
| CAS:71675-85-9 | ChemIDplus |
| Citations |
|---|