EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N2O |
| Net Charge | 0 |
| Average Mass | 136.154 |
| Monoisotopic Mass | 136.06366 |
| SMILES | NC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C7H8N2O/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H2,9,10) |
| InChIKey | GSCPDZHWVNUUFI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of a NAD+ ADP-ribosyltransferase (EC 2.4.2.30). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-aminobenzamide (CHEBI:64042) has role EC 2.4.2.30 (NAD+ ADP-ribosyltransferase) inhibitor (CHEBI:62913) |
| 3-aminobenzamide (CHEBI:64042) is a benzamides (CHEBI:22702) |
| 3-aminobenzamide (CHEBI:64042) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3-aminobenzamide |
| Synonyms | Source |
|---|---|
| 3-aminobenzoic acid amide | ChEBI |
| 3-H2NC6H4CONH2 | ChEBI |
| aniline-3-carboxamide | ChEBI |
| m-aminobenzamide | ChemIDplus |
| meta-aminobenzamide | ChEBI |
| Citations |
|---|