EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H72N7O17P3S |
| Net Charge | 0 |
| Average Mass | 1048.037 |
| Monoisotopic Mass | 1047.39182 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCC[C@H](C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C40H72N7O17P3S/c1-25(2)11-8-12-26(3)13-9-14-27(4)15-10-16-28(5)39(52)68-20-19-42-30(48)17-18-43-37(51)34(50)40(6,7)22-61-67(58,59)64-66(56,57)60-21-29-33(63-65(53,54)55)32(49)38(62-29)47-24-46-31-35(41)44-23-45-36(31)47/h23-29,32-34,38,49-50H,8-22H2,1-7H3,(H,42,48)(H,43,51)(H,56,57)(H,58,59)(H2,41,44,45)(H2,53,54,55)/t26?,27?,28-,29+,32+,33+,34-,38+/m0/s1 |
| InChIKey | XYJPSQPVCBNZHT-DHBXAFLLSA-N |
| Roles Classification |
|---|
| Chemical Roles: | acyl donor Any donor that can transfer acyl groups between molecular entities. acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-pristanoyl-CoA (CHEBI:64039) is a pristanoyl-CoA (CHEBI:51341) |
| (2S)-pristanoyl-CoA (CHEBI:64039) is conjugate acid of (2S)-pristanoyl-CoA(4−) (CHEBI:77099) |
| Incoming Relation(s) |
| (2S,6R,10R)-pristanoyl-CoA (CHEBI:747536) is a (2S)-pristanoyl-CoA (CHEBI:64039) |
| (2S)-pristanoyl-CoA(4−) (CHEBI:77099) is conjugate base of (2S)-pristanoyl-CoA (CHEBI:64039) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(2S)-2,6,10,14-tetramethylpentadecanoylsulfanyl]ethyl}amino)propyl]amino}butyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (2S)-2,6,10,14-tetramethylpentadecanoyl-CoA | ChEBI |
| (2S)-2,6,10,14-tetramethylpentadecanoyl-coenzyme A | ChEBI |
| (2S)-pristanoyl-coenzyme A | ChEBI |