EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H37NO2 |
| Net Charge | 0 |
| Average Mass | 323.521 |
| Monoisotopic Mass | 323.28243 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h6-7,9-10,22H,2-5,8,11-19H2,1H3,(H,21,23)/b7-6-,10-9- |
| InChIKey | KQXDGUVSAAQARU-HZJYTTRNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the action of fatty acid amide hydrolase (EC 3.5.1.99). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linoleoyl ethanolamide (CHEBI:64032) has functional parent linoleic acid (CHEBI:17351) |
| linoleoyl ethanolamide (CHEBI:64032) has role EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor (CHEBI:64033) |
| linoleoyl ethanolamide (CHEBI:64032) is a N-acylethanolamine 18:2 (CHEBI:134159) |
| IUPAC Name |
|---|
| (9Z,12Z)-N-(2-hydroxyethyl)octadeca-9,12-dienamide |
| Synonyms | Source |
|---|---|
| (9Z,12Z)-N-(2-Hydroxyethyl)octadeca-9,12-dien-1-amide | ChemIDplus |
| Anandamide (18:2, n-6) | LIPID MAPS |
| N-(9Z,12Z-octadecadienoyl)-ethanolamine | LIPID MAPS |
| N-cis-9-cis-12-octadecadienoylethanolamine | LIPID MAPS |
| Linoleamide MEA | HMDB |
| Linoleic ethanolamide | ChemIDplus |
| UniProt Name | Source |
|---|---|
| N-(9Z,12Z-octadecadienoyl)-ethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| EP1263286 | Patent |
| HMDB0012252 | HMDB |
| LMFA08040004 | LIPID MAPS |
| US5599548 | Patent |
| US5716627 | Patent |
| US6440434 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7028984 | Reaxys |
| CAS:68171-52-8 | ChemIDplus |
| Citations |
|---|